C22H27NO2S — CID 57155076
5,5-dimethyl-1-(4-methylphenyl)sulfonyl-2,3,4,4a,10,10a-hexahydrobenzo[g]quinoline (PubChem CID 57155076) has the molecular formula C22H27NO2S and a molecular weight of 369.53 g/mol. Its IUPAC name is 5,5-dimethyl-1-(4-methylphenyl)sulfonyl-2,3,4,4a,10,10a-hexahydrobenzo[g]quinoline.
| Compound Name | 5,5-dimethyl-1-(4-methylphenyl)sulfonyl-2,3,4,4a,10,10a-hexahydrobenzo[g]quinoline |
|---|---|
| PubChem CID | 57155076 |
| Molecular Formula | C22H27NO2S |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 5,5-dimethyl-1-(4-methylphenyl)sulfonyl-2,3,4,4a,10,10a-hexahydrobenzo[g]quinoline |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC3C2Cc2ccccc2C3(C)C)cc1 |
| InChI | InChI=1S/C22H27NO2S/c1-16-10-12-18(13-11-16)26(24,25)23-14-6-9-20-21(23)15-17-7-4-5-8-19(17)22(20,2)3/h4-5,7-8,10-13,20-21H,6,9,14-15H2,1-3H3 |
| InChIKey | ULCQMJKAQPXBGL-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |