C27H35NO3S — CID 70898247
4-butoxy-17-(4-methylphenyl)sulfonyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene (PubChem CID 70898247) has the molecular formula C27H35NO3S and a molecular weight of 453.65 g/mol. Its IUPAC name is 4-butoxy-17-(4-methylphenyl)sulfonyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene.
| Compound Name | 4-butoxy-17-(4-methylphenyl)sulfonyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 70898247 |
| Molecular Formula | C27H35NO3S |
| Molecular Weight | 453.65 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | 4-butoxy-17-(4-methylphenyl)sulfonyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
| SMILES | CCCCOc1ccc2c(c1)C13CCCCC1C(C2)N(S(=O)(=O)c1ccc(C)cc1)CC3 |
| InChI | InChI=1S/C27H35NO3S/c1-3-4-17-31-22-11-10-21-18-26-24-7-5-6-14-27(24,25(21)19-22)15-16-28(26)32(29,30)23-12-8-20(2)9-13-23/h8-13,19,24,26H,3-7,14-18H2,1-2H3 |
| InChIKey | CTDMZDMXUPTNKN-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.65 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|