C24H34ClNO3 — CID 68576672
tert-butyl (1R,9R,10R)-4-(3-chloropropoxy)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carboxylate (PubChem CID 68576672) has the molecular formula C24H34ClNO3 and a molecular weight of 419.99 g/mol. Its IUPAC name is tert-butyl (1R,9R,10R)-4-(3-chloropropoxy)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carboxylate.
| Compound Name | tert-butyl (1R,9R,10R)-4-(3-chloropropoxy)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carboxylate |
|---|---|
| PubChem CID | 68576672 |
| Molecular Formula | C24H34ClNO3 |
| Molecular Weight | 419.99 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | tert-butyl (1R,9R,10R)-4-(3-chloropropoxy)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@]23CCCC[C@H]2[C@H]1Cc1ccc(OCCCCl)cc13 |
| InChI | InChI=1S/C24H34ClNO3/c1-23(2,3)29-22(27)26-13-11-24-10-5-4-7-19(24)21(26)15-17-8-9-18(16-20(17)24)28-14-6-12-25/h8-9,16,19,21H,4-7,10-15H2,1-3H3/t19-,21+,24+/m0/s1 |
| InChIKey | RUTIOGLQKLHHKA-XZDHIHRUSA-N |
| XLogP | 5.69 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.99 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|