C20H24Cl3NO2 — CID 159219100
2,2,2-trichloroethyl 4-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carboxylate (PubChem CID 159219100) has the molecular formula C20H24Cl3NO2 and a molecular weight of 416.78 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 4-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carboxylate.
| Compound Name | 2,2,2-trichloroethyl 4-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carboxylate |
|---|---|
| PubChem CID | 159219100 |
| Molecular Formula | C20H24Cl3NO2 |
| Molecular Weight | 416.78 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | 2,2,2-trichloroethyl 4-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carboxylate |
| SMILES | Cc1ccc2c(c1)C13CCCCC1C(C2)N(C(=O)OCC(Cl)(Cl)Cl)CC3 |
| InChI | InChI=1S/C20H24Cl3NO2/c1-13-5-6-14-11-17-15-4-2-3-7-19(15,16(14)10-13)8-9-24(17)18(25)26-12-20(21,22)23/h5-6,10,15,17H,2-4,7-9,11-12H2,1H3 |
| InChIKey | KRLKYFBUYBQRTA-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.78 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|