C21H24F3NO2 — CID 69254238
ethenyl (1R,9R,10R)-4-(2,2,2-trifluoroethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carboxylate (PubChem CID 69254238) has the molecular formula C21H24F3NO2 and a molecular weight of 379.42 g/mol. Its IUPAC name is ethenyl (1R,9R,10R)-4-(2,2,2-trifluoroethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carboxylate.
| Compound Name | ethenyl (1R,9R,10R)-4-(2,2,2-trifluoroethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carboxylate |
|---|---|
| PubChem CID | 69254238 |
| Molecular Formula | C21H24F3NO2 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | ethenyl (1R,9R,10R)-4-(2,2,2-trifluoroethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carboxylate |
| SMILES | C=COC(=O)N1CC[C@]23CCCC[C@H]2[C@H]1Cc1ccc(CC(F)(F)F)cc13 |
| InChI | InChI=1S/C21H24F3NO2/c1-2-27-19(26)25-10-9-20-8-4-3-5-16(20)18(25)12-15-7-6-14(11-17(15)20)13-21(22,23)24/h2,6-7,11,16,18H,1,3-5,8-10,12-13H2/t16-,18+,20+/m0/s1 |
| InChIKey | QJAKWFLZXAEYTO-ILZDJORESA-N |
| XLogP | 5.13 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|