C19H23NO2 — CID 91507490
ethenyl (1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-triene-17-carboxylate (PubChem CID 91507490) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is ethenyl (1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-triene-17-carboxylate.
| Compound Name | ethenyl (1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-triene-17-carboxylate |
|---|---|
| PubChem CID | 91507490 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | ethenyl (1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-triene-17-carboxylate |
| SMILES | C=COC(=O)N1CC[C@]23CCCC[C@H]2[C@H]1Cc1ccccc13 |
| InChI | InChI=1S/C19H23NO2/c1-2-22-18(21)20-12-11-19-10-6-5-9-16(19)17(20)13-14-7-3-4-8-15(14)19/h2-4,7-8,16-17H,1,5-6,9-13H2/t16-,17+,19-/m0/s1 |
| InChIKey | RIAITZKZBMNWHW-SCTDSRPQSA-N |
| XLogP | 4.03 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|