C17H23NO3S — CID 11609465
(1R,3R,5R,7S)-1-methyl-8-(4-methylphenyl)sulfonyl-5-propan-2-yl-4-oxa-8-azatricyclo[5.1.0.03,5]octane (PubChem CID 11609465) has the molecular formula C17H23NO3S and a molecular weight of 321.44 g/mol. Its IUPAC name is (1R,3R,5R,7S)-1-methyl-8-(4-methylphenyl)sulfonyl-5-propan-2-yl-4-oxa-8-azatricyclo[5.1.0.03,5]octane.
| Compound Name | (1R,3R,5R,7S)-1-methyl-8-(4-methylphenyl)sulfonyl-5-propan-2-yl-4-oxa-8-azatricyclo[5.1.0.03,5]octane |
|---|---|
| PubChem CID | 11609465 |
| Molecular Formula | C17H23NO3S |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | (1R,3R,5R,7S)-1-methyl-8-(4-methylphenyl)sulfonyl-5-propan-2-yl-4-oxa-8-azatricyclo[5.1.0.03,5]octane |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@H]3C[C@]4(C(C)C)O[C@@H]4C[C@]32C)cc1 |
| InChI | InChI=1S/C17H23NO3S/c1-11(2)17-9-14-16(4,10-15(17)21-17)18(14)22(19,20)13-7-5-12(3)6-8-13/h5-8,11,14-15H,9-10H2,1-4H3/t14-,15+,16+,17+,18?/m0/s1 |
| InChIKey | SQNUULGDYOQNRY-QHBCJLDCSA-N |
| XLogP | 2.71 |
| TPSA | 49.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|