C15H19NO3S — CID 11522162
(1R,3R,5S,7S)-1,7-dimethyl-8-(4-methylphenyl)sulfonyl-4-oxa-8-azatricyclo[5.1.0.03,5]octane (PubChem CID 11522162) has the molecular formula C15H19NO3S and a molecular weight of 293.39 g/mol. Its IUPAC name is (1R,3R,5S,7S)-1,7-dimethyl-8-(4-methylphenyl)sulfonyl-4-oxa-8-azatricyclo[5.1.0.03,5]octane.
| Compound Name | (1R,3R,5S,7S)-1,7-dimethyl-8-(4-methylphenyl)sulfonyl-4-oxa-8-azatricyclo[5.1.0.03,5]octane |
|---|---|
| PubChem CID | 11522162 |
| Molecular Formula | C15H19NO3S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | (1R,3R,5S,7S)-1,7-dimethyl-8-(4-methylphenyl)sulfonyl-4-oxa-8-azatricyclo[5.1.0.03,5]octane |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@]3(C)C[C@H]4O[C@H]4C[C@]23C)cc1 |
| InChI | InChI=1S/C15H19NO3S/c1-10-4-6-11(7-5-10)20(17,18)16-14(2)8-12-13(19-12)9-15(14,16)3/h4-7,12-13H,8-9H2,1-3H3/t12-,13+,14-,15+,16? |
| InChIKey | YGVNUGNRWIBDSR-GJZITSJHSA-N |
| XLogP | 2.08 |
| TPSA | 49.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|