C20H27NO2S — CID 12033703
3',3'-dimethyl-1'-(4-methylphenyl)sulfonylspiro[adamantane-2,2'-aziridine] (PubChem CID 12033703) has the molecular formula C20H27NO2S and a molecular weight of 345.51 g/mol. Its IUPAC name is 3',3'-dimethyl-1'-(4-methylphenyl)sulfonylspiro[adamantane-2,2'-aziridine].
| Compound Name | 3',3'-dimethyl-1'-(4-methylphenyl)sulfonylspiro[adamantane-2,2'-aziridine] |
|---|---|
| PubChem CID | 12033703 |
| Molecular Formula | C20H27NO2S |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | 3',3'-dimethyl-1'-(4-methylphenyl)sulfonylspiro[adamantane-2,2'-aziridine] |
| SMILES | Cc1ccc(S(=O)(=O)N2C(C)(C)C23C2CC4CC(C2)CC3C4)cc1 |
| InChI | InChI=1S/C20H27NO2S/c1-13-4-6-18(7-5-13)24(22,23)21-19(2,3)20(21)16-9-14-8-15(11-16)12-17(20)10-14/h4-7,14-17H,8-12H2,1-3H3 |
| InChIKey | SKYKNSCRNUNLTM-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|