C13H14Br3NO2S — CID 98172762
(1R,3S,4S,6S)-3,4-dibromo-7-(4-bromophenyl)sulfonyl-1-methyl-7-azabicyclo[4.1.0]heptane (PubChem CID 98172762) has the molecular formula C13H14Br3NO2S and a molecular weight of 488.04 g/mol. Its IUPAC name is (1R,3S,4S,6S)-3,4-dibromo-7-(4-bromophenyl)sulfonyl-1-methyl-7-azabicyclo[4.1.0]heptane.
| Compound Name | (1R,3S,4S,6S)-3,4-dibromo-7-(4-bromophenyl)sulfonyl-1-methyl-7-azabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 98172762 |
| Molecular Formula | C13H14Br3NO2S |
| Molecular Weight | 488.04 g/mol |
| Exact Mass | 484.83 |
| IUPAC Name | (1R,3S,4S,6S)-3,4-dibromo-7-(4-bromophenyl)sulfonyl-1-methyl-7-azabicyclo[4.1.0]heptane |
| SMILES | C[C@@]12C[C@H](Br)[C@@H](Br)C[C@@H]1N2S(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H14Br3NO2S/c1-13-7-11(16)10(15)6-12(13)17(13)20(18,19)9-4-2-8(14)3-5-9/h2-5,10-12H,6-7H2,1H3/t10-,11-,12-,13+,17?/m0/s1 |
| InChIKey | XWPWDJLWZFBLCO-QLQLFNHPSA-N |
| XLogP | 3.90 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.04 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|