C13H14BrNO2S — CID 98554452
(1S,6S)-7-(4-bromophenyl)sulfonyl-1-methyl-7-azabicyclo[4.1.0]hept-3-ene (PubChem CID 98554452) has the molecular formula C13H14BrNO2S and a molecular weight of 328.23 g/mol. Its IUPAC name is (1S,6S)-7-(4-bromophenyl)sulfonyl-1-methyl-7-azabicyclo[4.1.0]hept-3-ene.
| Compound Name | (1S,6S)-7-(4-bromophenyl)sulfonyl-1-methyl-7-azabicyclo[4.1.0]hept-3-ene |
|---|---|
| PubChem CID | 98554452 |
| Molecular Formula | C13H14BrNO2S |
| Molecular Weight | 328.23 g/mol |
| Exact Mass | 326.99 |
| IUPAC Name | (1S,6S)-7-(4-bromophenyl)sulfonyl-1-methyl-7-azabicyclo[4.1.0]hept-3-ene |
| SMILES | C[C@]12CC=CC[C@@H]1N2S(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H14BrNO2S/c1-13-9-3-2-4-12(13)15(13)18(16,17)11-7-5-10(14)6-8-11/h2-3,5-8,12H,4,9H2,1H3/t12-,13-,15?/m0/s1 |
| InChIKey | PKCQYNKMTQUWBW-QNIGDANOSA-N |
| XLogP | 2.93 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.23 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|