C16H22BrNO3S — CID 110157070
(4aS,8aR)-6-(4-bromophenyl)sulfonyl-2,2-dimethyl-4,4a,5,7,8,8a-hexahydro-3H-pyrano[3,2-c]pyridine (PubChem CID 110157070) has the molecular formula C16H22BrNO3S and a molecular weight of 388.33 g/mol. Its IUPAC name is (4aS,8aR)-6-(4-bromophenyl)sulfonyl-2,2-dimethyl-4,4a,5,7,8,8a-hexahydro-3H-pyrano[3,2-c]pyridine.
| Compound Name | (4aS,8aR)-6-(4-bromophenyl)sulfonyl-2,2-dimethyl-4,4a,5,7,8,8a-hexahydro-3H-pyrano[3,2-c]pyridine |
|---|---|
| PubChem CID | 110157070 |
| Molecular Formula | C16H22BrNO3S |
| Molecular Weight | 388.33 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | (4aS,8aR)-6-(4-bromophenyl)sulfonyl-2,2-dimethyl-4,4a,5,7,8,8a-hexahydro-3H-pyrano[3,2-c]pyridine |
| SMILES | CC1(C)CC[C@H]2CN(S(=O)(=O)c3ccc(Br)cc3)CC[C@H]2O1 |
| InChI | InChI=1S/C16H22BrNO3S/c1-16(2)9-7-12-11-18(10-8-15(12)21-16)22(19,20)14-5-3-13(17)4-6-14/h3-6,12,15H,7-11H2,1-2H3/t12-,15+/m0/s1 |
| InChIKey | WKKAFYDUTMLSDF-SWLSCSKDSA-N |
| XLogP | 3.42 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |