C15H21BrN2O4S — CID 69082826
1-(4-bromophenyl)sulfonyl-4-[(oxetan-3-ylamino)methyl]piperidin-4-ol (PubChem CID 69082826) has the molecular formula C15H21BrN2O4S and a molecular weight of 405.31 g/mol. Its IUPAC name is 1-(4-bromophenyl)sulfonyl-4-[(oxetan-3-ylamino)methyl]piperidin-4-ol.
| Compound Name | 1-(4-bromophenyl)sulfonyl-4-[(oxetan-3-ylamino)methyl]piperidin-4-ol |
|---|---|
| PubChem CID | 69082826 |
| Molecular Formula | C15H21BrN2O4S |
| Molecular Weight | 405.31 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | 1-(4-bromophenyl)sulfonyl-4-[(oxetan-3-ylamino)methyl]piperidin-4-ol |
| SMILES | O=S(=O)(c1ccc(Br)cc1)N1CCC(O)(CNC2COC2)CC1 |
| InChI | InChI=1S/C15H21BrN2O4S/c16-12-1-3-14(4-2-12)23(20,21)18-7-5-15(19,6-8-18)11-17-13-9-22-10-13/h1-4,13,17,19H,5-11H2 |
| InChIKey | NDQKDUKPKSIZCN-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.31 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |