C17H25BrN2O5S — CID 86695697
tert-butyl N-[1-(4-bromophenyl)sulfonyl-4-(hydroxymethyl)piperidin-4-yl]carbamate (PubChem CID 86695697) has the molecular formula C17H25BrN2O5S and a molecular weight of 449.37 g/mol. Its IUPAC name is tert-butyl N-[1-(4-bromophenyl)sulfonyl-4-(hydroxymethyl)piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-(4-bromophenyl)sulfonyl-4-(hydroxymethyl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 86695697 |
| Molecular Formula | C17H25BrN2O5S |
| Molecular Weight | 449.37 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | tert-butyl N-[1-(4-bromophenyl)sulfonyl-4-(hydroxymethyl)piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(CO)CCN(S(=O)(=O)c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C17H25BrN2O5S/c1-16(2,3)25-15(22)19-17(12-21)8-10-20(11-9-17)26(23,24)14-6-4-13(18)5-7-14/h4-7,21H,8-12H2,1-3H3,(H,19,22) |
| InChIKey | VOKGILPNGRNIGX-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.37 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |