C19H29N3O7 — CID 100668584
tert-butyl N-[1-(4,5-dimethoxy-2-nitrophenyl)-4-(hydroxymethyl)piperidin-4-yl]carbamate (PubChem CID 100668584) has the molecular formula C19H29N3O7 and a molecular weight of 411.46 g/mol. Its IUPAC name is tert-butyl N-[1-(4,5-dimethoxy-2-nitrophenyl)-4-(hydroxymethyl)piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-(4,5-dimethoxy-2-nitrophenyl)-4-(hydroxymethyl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 100668584 |
| Molecular Formula | C19H29N3O7 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | tert-butyl N-[1-(4,5-dimethoxy-2-nitrophenyl)-4-(hydroxymethyl)piperidin-4-yl]carbamate |
| SMILES | COc1cc(N2CCC(CO)(NC(=O)OC(C)(C)C)CC2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C19H29N3O7/c1-18(2,3)29-17(24)20-19(12-23)6-8-21(9-7-19)13-10-15(27-4)16(28-5)11-14(13)22(25)26/h10-11,23H,6-9,12H2,1-5H3,(H,20,24) |
| InChIKey | PRLPWSOIWUNNHM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 123.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|