C18H25N3O6 — CID 178015628
tert-butyl 6-(2,5-dimethoxy-4-nitrophenyl)-2,6-diazaspiro[3.3]heptane-2-carboxylate (PubChem CID 178015628) has the molecular formula C18H25N3O6 and a molecular weight of 379.41 g/mol. Its IUPAC name is tert-butyl 6-(2,5-dimethoxy-4-nitrophenyl)-2,6-diazaspiro[3.3]heptane-2-carboxylate.
| Compound Name | tert-butyl 6-(2,5-dimethoxy-4-nitrophenyl)-2,6-diazaspiro[3.3]heptane-2-carboxylate |
|---|---|
| PubChem CID | 178015628 |
| Molecular Formula | C18H25N3O6 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | tert-butyl 6-(2,5-dimethoxy-4-nitrophenyl)-2,6-diazaspiro[3.3]heptane-2-carboxylate |
| SMILES | COc1cc([N+](=O)[O-])c(OC)cc1N1CC2(CN(C(=O)OC(C)(C)C)C2)C1 |
| InChI | InChI=1S/C18H25N3O6/c1-17(2,3)27-16(22)20-10-18(11-20)8-19(9-18)12-6-15(26-5)13(21(23)24)7-14(12)25-4/h6-7H,8-11H2,1-5H3 |
| InChIKey | UFOANRPVFXZPJI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 94.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|