C25H38N4O5 — CID 164853522
tert-butyl 3-[3-(5-methoxy-2-methyl-4-nitrophenyl)-3,9-diazaspiro[5.5]undecan-9-yl]azetidine-1-carboxylate (PubChem CID 164853522) has the molecular formula C25H38N4O5 and a molecular weight of 474.60 g/mol. Its IUPAC name is tert-butyl 3-[3-(5-methoxy-2-methyl-4-nitrophenyl)-3,9-diazaspiro[5.5]undecan-9-yl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[3-(5-methoxy-2-methyl-4-nitrophenyl)-3,9-diazaspiro[5.5]undecan-9-yl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 164853522 |
| Molecular Formula | C25H38N4O5 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.28 |
| IUPAC Name | tert-butyl 3-[3-(5-methoxy-2-methyl-4-nitrophenyl)-3,9-diazaspiro[5.5]undecan-9-yl]azetidine-1-carboxylate |
| SMILES | COc1cc(N2CCC3(CC2)CCN(C2CN(C(=O)OC(C)(C)C)C2)CC3)c(C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H38N4O5/c1-18-14-21(29(31)32)22(33-5)15-20(18)27-12-8-25(9-13-27)6-10-26(11-7-25)19-16-28(17-19)23(30)34-24(2,3)4/h14-15,19H,6-13,16-17H2,1-5H3 |
| InChIKey | RKCYTVXQJJJLPE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 88.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|