C17H24BrN3O5 — CID 178082221
tert-butyl N-[[1-(4-bromo-2-nitrophenyl)-4-hydroxypiperidin-4-yl]methyl]carbamate (PubChem CID 178082221) has the molecular formula C17H24BrN3O5 and a molecular weight of 430.30 g/mol. Its IUPAC name is tert-butyl N-[[1-(4-bromo-2-nitrophenyl)-4-hydroxypiperidin-4-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-(4-bromo-2-nitrophenyl)-4-hydroxypiperidin-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 178082221 |
| Molecular Formula | C17H24BrN3O5 |
| Molecular Weight | 430.30 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | tert-butyl N-[[1-(4-bromo-2-nitrophenyl)-4-hydroxypiperidin-4-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1(O)CCN(c2ccc(Br)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C17H24BrN3O5/c1-16(2,3)26-15(22)19-11-17(23)6-8-20(9-7-17)13-5-4-12(18)10-14(13)21(24)25/h4-5,10,23H,6-9,11H2,1-3H3,(H,19,22) |
| InChIKey | NTAWTXXHBFHUPP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 104.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|