C15H21BrN2O4S — CID 174624537
[4-(4-bromophenyl)sulfonylpiperazin-1-yl] 2,2-dimethylpropanoate (PubChem CID 174624537) has the molecular formula C15H21BrN2O4S and a molecular weight of 405.31 g/mol. Its IUPAC name is [4-(4-bromophenyl)sulfonylpiperazin-1-yl] 2,2-dimethylpropanoate.
| Compound Name | [4-(4-bromophenyl)sulfonylpiperazin-1-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 174624537 |
| Molecular Formula | C15H21BrN2O4S |
| Molecular Weight | 405.31 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | [4-(4-bromophenyl)sulfonylpiperazin-1-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)ON1CCN(S(=O)(=O)c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C15H21BrN2O4S/c1-15(2,3)14(19)22-17-8-10-18(11-9-17)23(20,21)13-6-4-12(16)5-7-13/h4-7H,8-11H2,1-3H3 |
| InChIKey | GZQAARUKWSHJIC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |