C22H33BrN3O5S+ — CID 54289520
tert-butyl 1-[4-(4-bromophenyl)sulfonyl-1,4-diazepane-1-carbonyl]piperidin-1-ium-1-carboxylate (PubChem CID 54289520) has the molecular formula C22H33BrN3O5S+ and a molecular weight of 531.49 g/mol. Its IUPAC name is tert-butyl 1-[4-(4-bromophenyl)sulfonyl-1,4-diazepane-1-carbonyl]piperidin-1-ium-1-carboxylate.
| Compound Name | tert-butyl 1-[4-(4-bromophenyl)sulfonyl-1,4-diazepane-1-carbonyl]piperidin-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 54289520 |
| Molecular Formula | C22H33BrN3O5S+ |
| Molecular Weight | 531.49 g/mol |
| Exact Mass | 530.13 |
| IUPAC Name | tert-butyl 1-[4-(4-bromophenyl)sulfonyl-1,4-diazepane-1-carbonyl]piperidin-1-ium-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)[N+]1(C(=O)N2CCCN(S(=O)(=O)c3ccc(Br)cc3)CC2)CCCCC1 |
| InChI | InChI=1S/C22H33BrN3O5S/c1-22(2,3)31-21(28)26(16-5-4-6-17-26)20(27)24-12-7-13-25(15-14-24)32(29,30)19-10-8-18(23)9-11-19/h8-11H,4-7,12-17H2,1-3H3/q+1 |
| InChIKey | GFSNCNWOKYPTFI-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.49 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|