C15H20BrClN2O4S — CID 123837669
N-[[1-(4-bromophenyl)sulfonyl-4-hydroxypiperidin-4-yl]methyl]-2-chloropropanamide (PubChem CID 123837669) has the molecular formula C15H20BrClN2O4S and a molecular weight of 439.76 g/mol. Its IUPAC name is N-[[1-(4-bromophenyl)sulfonyl-4-hydroxypiperidin-4-yl]methyl]-2-chloropropanamide.
| Compound Name | N-[[1-(4-bromophenyl)sulfonyl-4-hydroxypiperidin-4-yl]methyl]-2-chloropropanamide |
|---|---|
| PubChem CID | 123837669 |
| Molecular Formula | C15H20BrClN2O4S |
| Molecular Weight | 439.76 g/mol |
| Exact Mass | 438.00 |
| IUPAC Name | N-[[1-(4-bromophenyl)sulfonyl-4-hydroxypiperidin-4-yl]methyl]-2-chloropropanamide |
| SMILES | CC(Cl)C(=O)NCC1(O)CCN(S(=O)(=O)c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C15H20BrClN2O4S/c1-11(17)14(20)18-10-15(21)6-8-19(9-7-15)24(22,23)13-4-2-12(16)3-5-13/h2-5,11,21H,6-10H2,1H3,(H,18,20) |
| InChIKey | XIPGTUIHRSMIPA-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.76 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|