C12H16BrNO2S — CID 63219211
1-(4-bromophenyl)sulfonyl-2,2-dimethylpyrrolidine (PubChem CID 63219211) has the molecular formula C12H16BrNO2S and a molecular weight of 318.24 g/mol. Its IUPAC name is 1-(4-bromophenyl)sulfonyl-2,2-dimethylpyrrolidine.
| Compound Name | 1-(4-bromophenyl)sulfonyl-2,2-dimethylpyrrolidine |
|---|---|
| PubChem CID | 63219211 |
| Molecular Formula | C12H16BrNO2S |
| Molecular Weight | 318.24 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | 1-(4-bromophenyl)sulfonyl-2,2-dimethylpyrrolidine |
| SMILES | CC1(C)CCCN1S(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C12H16BrNO2S/c1-12(2)8-3-9-14(12)17(15,16)11-6-4-10(13)5-7-11/h4-7H,3,8-9H2,1-2H3 |
| InChIKey | FTCRVNOMWGLJDE-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.24 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |