C13H18BrNO2S — CID 158822852
1-(3-bromophenyl)sulfonyl-2,2-dimethylpiperidine (PubChem CID 158822852) has the molecular formula C13H18BrNO2S and a molecular weight of 332.26 g/mol. Its IUPAC name is 1-(3-bromophenyl)sulfonyl-2,2-dimethylpiperidine.
| Compound Name | 1-(3-bromophenyl)sulfonyl-2,2-dimethylpiperidine |
|---|---|
| PubChem CID | 158822852 |
| Molecular Formula | C13H18BrNO2S |
| Molecular Weight | 332.26 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 1-(3-bromophenyl)sulfonyl-2,2-dimethylpiperidine |
| SMILES | CC1(C)CCCCN1S(=O)(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C13H18BrNO2S/c1-13(2)8-3-4-9-15(13)18(16,17)12-7-5-6-11(14)10-12/h5-7,10H,3-4,8-9H2,1-2H3 |
| InChIKey | IWBWSUXOUPLHIO-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.26 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |