C15H17NO3 — CID 15461724
(3aR,7aR)-3a-(1,3-benzodioxol-5-yl)-3,4,5,6,7,7a-hexahydro-1H-indol-2-one (PubChem CID 15461724) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is (3aR,7aR)-3a-(1,3-benzodioxol-5-yl)-3,4,5,6,7,7a-hexahydro-1H-indol-2-one.
| Compound Name | (3aR,7aR)-3a-(1,3-benzodioxol-5-yl)-3,4,5,6,7,7a-hexahydro-1H-indol-2-one |
|---|---|
| PubChem CID | 15461724 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | (3aR,7aR)-3a-(1,3-benzodioxol-5-yl)-3,4,5,6,7,7a-hexahydro-1H-indol-2-one |
| SMILES | O=C1C[C@@]2(c3ccc4c(c3)OCO4)CCCC[C@H]2N1 |
| InChI | InChI=1S/C15H17NO3/c17-14-8-15(6-2-1-3-13(15)16-14)10-4-5-11-12(7-10)19-9-18-11/h4-5,7,13H,1-3,6,8-9H2,(H,16,17)/t13-,15-/m1/s1 |
| InChIKey | OPGUOIIUAHEKKQ-UKRRQHHQSA-N |
| XLogP | 2.12 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |