About (2R)-N-[1-(1,3-benzodioxol-5-yl)cyclopropyl]-5-oxopyrrolidine-2-carboxamide
(2R)-N-[1-(1,3-benzodioxol-5-yl)cyclopropyl]-5-oxopyrrolidine-2-carboxamide (PubChem CID 127615822) has the molecular formula C15H16N2O4
and a molecular weight of 288.30 g/mol. Its IUPAC name is (2R)-N-[1-(1,3-benzodioxol-5-yl)cyclopropyl]-5-oxopyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | (2R)-N-[1-(1,3-benzodioxol-5-yl)cyclopropyl]-5-oxopyrrolidine-2-carboxamide |
| PubChem CID | 127615822 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | (2R)-N-[1-(1,3-benzodioxol-5-yl)cyclopropyl]-5-oxopyrrolidine-2-carboxamide |
| SMILES | O=C1CC[C@H](C(=O)NC2(c3ccc4c(c3)OCO4)CC2)N1 |
| InChI | InChI=1S/C15H16N2O4/c18-13-4-2-10(16-13)14(19)17-15(5-6-15)9-1-3-11-12(7-9)21-8-20-11/h1,3,7,10H,2,4-6,8H2,(H,16,18)(H,17,19)/t10-/m1/s1 |
| InChIKey | SVWDWMJSNJUWKC-SNVBAGLBSA-N |
| XLogP | 0.80 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-N-[1-(1,3-benzodioxol-5-yl)cyclopropyl]-5-oxopyrrolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N-[1-(1,3-benzodioxol-5-yl)cyclopropyl]-5-oxopyrrolidine-2-carboxamide?
The IUPAC name of (2R)-N-[1-(1,3-benzodioxol-5-yl)cyclopropyl]-5-oxopyrrolidine-2-carboxamide (CID 127615822) is (2R)-N-[1-(1,3-benzodioxol-5-yl)cyclopropyl]-5-oxopyrrolidine-2-carboxamide.
What is the SMILES notation for (2R)-N-[1-(1,3-benzodioxol-5-yl)cyclopropyl]-5-oxopyrrolidine-2-carboxamide?
The canonical SMILES for (2R)-N-[1-(1,3-benzodioxol-5-yl)cyclopropyl]-5-oxopyrrolidine-2-carboxamide is O=C1CC[C@H](C(=O)NC2(c3ccc4c(c3)OCO4)CC2)N1.
What is the InChIKey of (2R)-N-[1-(1,3-benzodioxol-5-yl)cyclopropyl]-5-oxopyrrolidine-2-carboxamide?
The InChIKey is SVWDWMJSNJUWKC-SNVBAGLBSA-N. The full InChI is InChI=1S/C15H16N2O4/c18-13-4-2-10(16-13)14(19)17-15(5-6-15)9-1-3-11-12(7-9)21-8-20-11/h1,3,7,10H,2,4-6,8H2,(H,16,18)(H,17,19)/t10-/m1/s1.
What are the key properties of (2R)-N-[1-(1,3-benzodioxol-5-yl)cyclopropyl]-5-oxopyrrolidine-2-carboxamide?
(2R)-N-[1-(1,3-benzodioxol-5-yl)cyclopropyl]-5-oxopyrrolidine-2-carboxamide has a molecular weight of 288.30 g/mol, XLogP of 0.80, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N-[1-(1,3-benzodioxol-5-yl)cyclopropyl]-5-oxopyrrolidine-2-carboxamide is sourced from PubChem (CID 127615822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).