C22H33NO4 — CID 170285017
(3aS,6E,7aS)-3a-(3,4-dimethoxyphenyl)-6-(2-methoxypropan-2-yloxymethylidene)-1-methyl-2,3,4,5,7,7a-hexahydroindole (PubChem CID 170285017) has the molecular formula C22H33NO4 and a molecular weight of 375.51 g/mol. Its IUPAC name is (3aS,6E,7aS)-3a-(3,4-dimethoxyphenyl)-6-(2-methoxypropan-2-yloxymethylidene)-1-methyl-2,3,4,5,7,7a-hexahydroindole.
| Compound Name | (3aS,6E,7aS)-3a-(3,4-dimethoxyphenyl)-6-(2-methoxypropan-2-yloxymethylidene)-1-methyl-2,3,4,5,7,7a-hexahydroindole |
|---|---|
| PubChem CID | 170285017 |
| Molecular Formula | C22H33NO4 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | (3aS,6E,7aS)-3a-(3,4-dimethoxyphenyl)-6-(2-methoxypropan-2-yloxymethylidene)-1-methyl-2,3,4,5,7,7a-hexahydroindole |
| SMILES | COc1ccc([C@@]23CC/C(=C\OC(C)(C)OC)C[C@@H]2N(C)CC3)cc1OC |
| InChI | InChI=1S/C22H33NO4/c1-21(2,26-6)27-15-16-9-10-22(11-12-23(3)20(22)13-16)17-7-8-18(24-4)19(14-17)25-5/h7-8,14-15,20H,9-13H2,1-6H3/b16-15+/t20-,22-/m0/s1 |
| InChIKey | BCGJTYUGWIWJEE-SCTAXSCYSA-N |
| XLogP | 4.11 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|