C20H27NO3 — CID 176592026
(3aR,6S,7aS)-3a-(3-cyclopropyl-4,5-dimethoxyphenyl)-1-methyl-3,6,7,7a-tetrahydro-2H-indol-6-ol (PubChem CID 176592026) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is (3aR,6S,7aS)-3a-(3-cyclopropyl-4,5-dimethoxyphenyl)-1-methyl-3,6,7,7a-tetrahydro-2H-indol-6-ol.
| Compound Name | (3aR,6S,7aS)-3a-(3-cyclopropyl-4,5-dimethoxyphenyl)-1-methyl-3,6,7,7a-tetrahydro-2H-indol-6-ol |
|---|---|
| PubChem CID | 176592026 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | (3aR,6S,7aS)-3a-(3-cyclopropyl-4,5-dimethoxyphenyl)-1-methyl-3,6,7,7a-tetrahydro-2H-indol-6-ol |
| SMILES | COc1cc([C@@]23C=C[C@@H](O)C[C@@H]2N(C)CC3)cc(C2CC2)c1OC |
| InChI | InChI=1S/C20H27NO3/c1-21-9-8-20(7-6-15(22)12-18(20)21)14-10-16(13-4-5-13)19(24-3)17(11-14)23-2/h6-7,10-11,13,15,18,22H,4-5,8-9,12H2,1-3H3/t15-,18+,20+/m1/s1 |
| InChIKey | DVESNSYPAMVGFL-BPAFIMBUSA-N |
| XLogP | 2.84 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|