C25H28F5N3O3 — CID 87980579
1-[(3aS,6R,7aS)-3a-(2-fluoro-3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[2-fluoro-3-(trifluoromethyl)phenyl]urea (PubChem CID 87980579) has the molecular formula C25H28F5N3O3 and a molecular weight of 513.51 g/mol. Its IUPAC name is 1-[(3aS,6R,7aS)-3a-(2-fluoro-3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[2-fluoro-3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(3aS,6R,7aS)-3a-(2-fluoro-3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[2-fluoro-3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 87980579 |
| Molecular Formula | C25H28F5N3O3 |
| Molecular Weight | 513.51 g/mol |
| Exact Mass | 513.21 |
| IUPAC Name | 1-[(3aS,6R,7aS)-3a-(2-fluoro-3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[2-fluoro-3-(trifluoromethyl)phenyl]urea |
| SMILES | COc1ccc([C@@]23CC[C@@H](NC(=O)Nc4cccc(C(F)(F)F)c4F)C[C@@H]2N(C)CC3)c(F)c1OC |
| InChI | InChI=1S/C25H28F5N3O3/c1-33-12-11-24(15-7-8-18(35-2)22(36-3)21(15)27)10-9-14(13-19(24)33)31-23(34)32-17-6-4-5-16(20(17)26)25(28,29)30/h4-8,14,19H,9-13H2,1-3H3,(H2,31,32,34)/t14-,19+,24+/m1/s1 |
| InChIKey | YIWQDWJMXUGFPJ-PBPZHQAMSA-N |
| XLogP | 5.32 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.51 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |