C22H32F3NO3S — CID 143136313
(7-methyl-8-azatetracyclo[8.6.0.01,6.011,16]hexadeca-11(16),12,14-trien-14-yl) trifluoromethanesulfonate;2-methylbutane (PubChem CID 143136313) has the molecular formula C22H32F3NO3S and a molecular weight of 447.56 g/mol. Its IUPAC name is (7-methyl-8-azatetracyclo[8.6.0.01,6.011,16]hexadeca-11(16),12,14-trien-14-yl) trifluoromethanesulfonate;2-methylbutane.
| Compound Name | (7-methyl-8-azatetracyclo[8.6.0.01,6.011,16]hexadeca-11(16),12,14-trien-14-yl) trifluoromethanesulfonate;2-methylbutane |
|---|---|
| PubChem CID | 143136313 |
| Molecular Formula | C22H32F3NO3S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | (7-methyl-8-azatetracyclo[8.6.0.01,6.011,16]hexadeca-11(16),12,14-trien-14-yl) trifluoromethanesulfonate;2-methylbutane |
| SMILES | CC1NCC2c3ccc(OS(=O)(=O)C(F)(F)F)cc3C23CCCCC13.CCC(C)C |
| InChI | InChI=1S/C17H20F3NO3S.C5H12/c1-10-13-4-2-3-7-16(13)14-8-11(24-25(22,23)17(18,19)20)5-6-12(14)15(16)9-21-10;1-4-5(2)3/h5-6,8,10,13,15,21H,2-4,7,9H2,1H3;5H,4H2,1-3H3 |
| InChIKey | ATORXFFPXSDSLM-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|