C13H12F3NO4S — CID 118110415
(8-oxo-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl) trifluoromethanesulfonate (PubChem CID 118110415) has the molecular formula C13H12F3NO4S and a molecular weight of 335.30 g/mol. Its IUPAC name is (8-oxo-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl) trifluoromethanesulfonate.
| Compound Name | (8-oxo-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 118110415 |
| Molecular Formula | C13H12F3NO4S |
| Molecular Weight | 335.30 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | (8-oxo-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl) trifluoromethanesulfonate |
| SMILES | O=C1c2ccc(OS(=O)(=O)C(F)(F)F)cc2C2CCNC1C2 |
| InChI | InChI=1S/C13H12F3NO4S/c14-13(15,16)22(19,20)21-8-1-2-9-10(6-8)7-3-4-17-11(5-7)12(9)18/h1-2,6-7,11,17H,3-5H2 |
| InChIKey | KYZIUYBMHXKHEL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|