C17H23N3O2 — CID 134490418
(1S,9S,10S)-17-methyl-5-nitro-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-amine (PubChem CID 134490418) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is (1S,9S,10S)-17-methyl-5-nitro-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-amine.
| Compound Name | (1S,9S,10S)-17-methyl-5-nitro-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-amine |
|---|---|
| PubChem CID | 134490418 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | (1S,9S,10S)-17-methyl-5-nitro-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-amine |
| SMILES | CN1CC[C@@]23CCCC[C@@H]2[C@@H]1Cc1cc([N+](=O)[O-])c(N)cc13 |
| InChI | InChI=1S/C17H23N3O2/c1-19-7-6-17-5-3-2-4-12(17)15(19)8-11-9-16(20(21)22)14(18)10-13(11)17/h9-10,12,15H,2-8,18H2,1H3/t12-,15+,17+/m1/s1 |
| InChIKey | RDJNSASQHRXOGO-PVUWLOKVSA-N |
| XLogP | 2.87 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|