C31H49NO2 — CID 45486258
(1R,9R,10R)-17-(cyclobutylmethyl)-5-(1-hydroxydecyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol (PubChem CID 45486258) has the molecular formula C31H49NO2 and a molecular weight of 467.74 g/mol. Its IUPAC name is (1R,9R,10R)-17-(cyclobutylmethyl)-5-(1-hydroxydecyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol.
| Compound Name | (1R,9R,10R)-17-(cyclobutylmethyl)-5-(1-hydroxydecyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol |
|---|---|
| PubChem CID | 45486258 |
| Molecular Formula | C31H49NO2 |
| Molecular Weight | 467.74 g/mol |
| Exact Mass | 467.38 |
| IUPAC Name | (1R,9R,10R)-17-(cyclobutylmethyl)-5-(1-hydroxydecyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol |
| SMILES | CCCCCCCCCC(O)c1cc2c(cc1O)[C@@]13CCCC[C@H]1[C@@H](C2)N(CC1CCC1)CC3 |
| InChI | InChI=1S/C31H49NO2/c1-2-3-4-5-6-7-8-15-29(33)25-19-24-20-28-26-14-9-10-16-31(26,27(24)21-30(25)34)17-18-32(28)22-23-12-11-13-23/h19,21,23,26,28-29,33-34H,2-18,20,22H2,1H3/t26-,28+,29?,31+/m0/s1 |
| InChIKey | FMPXAWVIKDQKEF-PWQGVFBWSA-N |
| XLogP | 7.42 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.74 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|