C25H40Cl2N2O — CID 44626746
(1R,9R,10R)-17-(cyclobutylmethyl)-5-(propylaminomethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol;dihydrochloride (PubChem CID 44626746) has the molecular formula C25H40Cl2N2O and a molecular weight of 455.51 g/mol. Its IUPAC name is (1R,9R,10R)-17-(cyclobutylmethyl)-5-(propylaminomethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol;dihydrochloride.
| Compound Name | (1R,9R,10R)-17-(cyclobutylmethyl)-5-(propylaminomethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol;dihydrochloride |
|---|---|
| PubChem CID | 44626746 |
| Molecular Formula | C25H40Cl2N2O |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | (1R,9R,10R)-17-(cyclobutylmethyl)-5-(propylaminomethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol;dihydrochloride |
| SMILES | CCCNCc1cc2c(cc1O)[C@@]13CCCC[C@H]1[C@@H](C2)N(CC1CCC1)CC3.Cl.Cl |
| InChI | InChI=1S/C25H38N2O.2ClH/c1-2-11-26-16-20-13-19-14-23-21-8-3-4-9-25(21,22(19)15-24(20)28)10-12-27(23)17-18-6-5-7-18;;/h13,15,18,21,23,26,28H,2-12,14,16-17H2,1H3;2*1H/t21-,23+,25+;;/m0../s1 |
| InChIKey | IBNHSOVFRGGSCK-RXKGWPALSA-N |
| XLogP | 5.59 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|