C25H36N2O — CID 135927289
(1R,9R,10R)-17-(cyclobutylmethyl)-5-(propyliminomethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol (PubChem CID 135927289) has the molecular formula C25H36N2O and a molecular weight of 380.58 g/mol. Its IUPAC name is (1R,9R,10R)-17-(cyclobutylmethyl)-5-(propyliminomethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol.
| Compound Name | (1R,9R,10R)-17-(cyclobutylmethyl)-5-(propyliminomethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol |
|---|---|
| PubChem CID | 135927289 |
| Molecular Formula | C25H36N2O |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.28 |
| IUPAC Name | (1R,9R,10R)-17-(cyclobutylmethyl)-5-(propyliminomethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol |
| SMILES | CCC/N=C/c1cc2c(cc1O)[C@@]13CCCC[C@H]1[C@@H](C2)N(CC1CCC1)CC3 |
| InChI | InChI=1S/C25H36N2O/c1-2-11-26-16-20-13-19-14-23-21-8-3-4-9-25(21,22(19)15-24(20)28)10-12-27(23)17-18-6-5-7-18/h13,15-16,18,21,23,28H,2-12,14,17H2,1H3/b26-16+/t21-,23+,25+/m0/s1 |
| InChIKey | FVEAOBHAHOCGCS-CMVMIGNMSA-N |
| XLogP | 5.08 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|