C31H44ClNO3 — CID 21457950
[(1R,9S,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] 10-chloro-10-oxodecanoate (PubChem CID 21457950) has the molecular formula C31H44ClNO3 and a molecular weight of 514.15 g/mol. Its IUPAC name is [(1R,9S,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] 10-chloro-10-oxodecanoate.
| Compound Name | [(1R,9S,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] 10-chloro-10-oxodecanoate |
|---|---|
| PubChem CID | 21457950 |
| Molecular Formula | C31H44ClNO3 |
| Molecular Weight | 514.15 g/mol |
| Exact Mass | 513.30 |
| IUPAC Name | [(1R,9S,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] 10-chloro-10-oxodecanoate |
| SMILES | O=C(Cl)CCCCCCCCC(=O)Oc1ccc2c(c1)[C@@]13CCCC[C@H]1[C@H](C2)N(CC1CCC1)CC3 |
| InChI | InChI=1S/C31H44ClNO3/c32-29(34)13-5-3-1-2-4-6-14-30(35)36-25-16-15-24-20-28-26-12-7-8-17-31(26,27(24)21-25)18-19-33(28)22-23-10-9-11-23/h15-16,21,23,26,28H,1-14,17-20,22H2/t26-,28-,31+/m0/s1 |
| InChIKey | NQYISUNQEMPGAA-JJXOYXEQSA-N |
| XLogP | 7.34 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.15 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|