C21H23Cl2NO — CID 10429578
(1S,9S,13S)-10-benzyl-3,5-dichloro-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-4-ol (PubChem CID 10429578) has the molecular formula C21H23Cl2NO and a molecular weight of 376.33 g/mol. Its IUPAC name is (1S,9S,13S)-10-benzyl-3,5-dichloro-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-4-ol.
| Compound Name | (1S,9S,13S)-10-benzyl-3,5-dichloro-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-4-ol |
|---|---|
| PubChem CID | 10429578 |
| Molecular Formula | C21H23Cl2NO |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | (1S,9S,13S)-10-benzyl-3,5-dichloro-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-4-ol |
| SMILES | C[C@@H]1[C@@H]2Cc3cc(Cl)c(O)c(Cl)c3[C@@]1(C)CCN2Cc1ccccc1 |
| InChI | InChI=1S/C21H23Cl2NO/c1-13-17-11-15-10-16(22)20(25)19(23)18(15)21(13,2)8-9-24(17)12-14-6-4-3-5-7-14/h3-7,10,13,17,25H,8-9,11-12H2,1-2H3/t13-,17+,21+/m1/s1 |
| InChIKey | VRJDMOMOIGTKNV-JRQSSSKMSA-N |
| XLogP | 5.42 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |