C19H23NO2 — CID 71716573
(1R,9R,13R)-10-(furan-2-ylmethyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol (PubChem CID 71716573) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is (1R,9R,13R)-10-(furan-2-ylmethyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol.
| Compound Name | (1R,9R,13R)-10-(furan-2-ylmethyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol |
|---|---|
| PubChem CID | 71716573 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | (1R,9R,13R)-10-(furan-2-ylmethyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol |
| SMILES | C[C@H]1[C@H]2Cc3ccc(O)cc3[C@]1(C)CCN2Cc1ccco1 |
| InChI | InChI=1S/C19H23NO2/c1-13-18-10-14-5-6-15(21)11-17(14)19(13,2)7-8-20(18)12-16-4-3-9-22-16/h3-6,9,11,13,18,21H,7-8,10,12H2,1-2H3/t13-,18+,19+/m0/s1 |
| InChIKey | ICHXZERPLTYYPM-MJXNMMHHSA-N |
| XLogP | 3.71 |
| TPSA | 36.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |