C20H29NO — CID 59334307
(1S,13R)-10-(cyclopropylmethyl)-1,3,5,13-tetramethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol (PubChem CID 59334307) has the molecular formula C20H29NO and a molecular weight of 299.46 g/mol. Its IUPAC name is (1S,13R)-10-(cyclopropylmethyl)-1,3,5,13-tetramethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol.
| Compound Name | (1S,13R)-10-(cyclopropylmethyl)-1,3,5,13-tetramethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol |
|---|---|
| PubChem CID | 59334307 |
| Molecular Formula | C20H29NO |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | (1S,13R)-10-(cyclopropylmethyl)-1,3,5,13-tetramethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol |
| SMILES | Cc1cc2c(c(C)c1O)[C@@]1(C)CCN(CC3CC3)C(C2)[C@@H]1C |
| InChI | InChI=1S/C20H29NO/c1-12-9-16-10-17-14(3)20(4,18(16)13(2)19(12)22)7-8-21(17)11-15-5-6-15/h9,14-15,17,22H,5-8,10-11H2,1-4H3/t14-,17?,20-/m0/s1 |
| InChIKey | TVJMLYLJBBFIKC-GCTQLOCRSA-N |
| XLogP | 3.94 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |