C20H25NO3 — CID 14863762
(5R)-5-[[(1R,9R,13R)-4-hydroxy-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]methyl]-3-methylideneoxolan-2-one (PubChem CID 14863762) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is (5R)-5-[[(1R,9R,13R)-4-hydroxy-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]methyl]-3-methylideneoxolan-2-one.
| Compound Name | (5R)-5-[[(1R,9R,13R)-4-hydroxy-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]methyl]-3-methylideneoxolan-2-one |
|---|---|
| PubChem CID | 14863762 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | (5R)-5-[[(1R,9R,13R)-4-hydroxy-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]methyl]-3-methylideneoxolan-2-one |
| SMILES | C=C1C[C@H](CN2CC[C@@]3(C)c4cc(O)ccc4C[C@@H]2[C@@H]3C)OC1=O |
| InChI | InChI=1S/C20H25NO3/c1-12-8-16(24-19(12)23)11-21-7-6-20(3)13(2)18(21)9-14-4-5-15(22)10-17(14)20/h4-5,10,13,16,18,22H,1,6-9,11H2,2-3H3/t13-,16+,18+,20+/m0/s1 |
| InChIKey | FXAWKCNYVHSHJZ-QRXJHHFZSA-N |
| XLogP | 2.79 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|