C19H25NO3 — CID 73355913
(5S)-5-[[(1S,9R,13R)-4-hydroxy-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]methyl]oxolan-2-one (PubChem CID 73355913) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is (5S)-5-[[(1S,9R,13R)-4-hydroxy-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]methyl]oxolan-2-one.
| Compound Name | (5S)-5-[[(1S,9R,13R)-4-hydroxy-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]methyl]oxolan-2-one |
|---|---|
| PubChem CID | 73355913 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | (5S)-5-[[(1S,9R,13R)-4-hydroxy-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]methyl]oxolan-2-one |
| SMILES | C[C@H]1[C@H]2Cc3ccc(O)cc3[C@@]1(C)CCN2C[C@@H]1CCC(=O)O1 |
| InChI | InChI=1S/C19H25NO3/c1-12-17-9-13-3-4-14(21)10-16(13)19(12,2)7-8-20(17)11-15-5-6-18(22)23-15/h3-4,10,12,15,17,21H,5-9,11H2,1-2H3/t12-,15-,17+,19-/m0/s1 |
| InChIKey | HHASRPPPJAXSNL-FRXJQCMVSA-N |
| XLogP | 2.62 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |