C30H41NO5 — CID 130251879
(1S,2R,10R,15S)-11-(cyclopropylmethyl)-15-ethyl-15-[3-(furan-3-ylmethoxy)propyl]-2-(1-methoxyethyl)-3-oxa-11-azatetracyclo[6.5.1.11,10.04,14]pentadeca-4,6,8(14)-trien-5-ol (PubChem CID 130251879) has the molecular formula C30H41NO5 and a molecular weight of 495.66 g/mol. Its IUPAC name is (1S,2R,10R,15S)-11-(cyclopropylmethyl)-15-ethyl-15-[3-(furan-3-ylmethoxy)propyl]-2-(1-methoxyethyl)-3-oxa-11-azatetracyclo[6.5.1.11,10.04,14]pentadeca-4,6,8(14)-trien-5-ol.
| Compound Name | (1S,2R,10R,15S)-11-(cyclopropylmethyl)-15-ethyl-15-[3-(furan-3-ylmethoxy)propyl]-2-(1-methoxyethyl)-3-oxa-11-azatetracyclo[6.5.1.11,10.04,14]pentadeca-4,6,8(14)-trien-5-ol |
|---|---|
| PubChem CID | 130251879 |
| Molecular Formula | C30H41NO5 |
| Molecular Weight | 495.66 g/mol |
| Exact Mass | 495.30 |
| IUPAC Name | (1S,2R,10R,15S)-11-(cyclopropylmethyl)-15-ethyl-15-[3-(furan-3-ylmethoxy)propyl]-2-(1-methoxyethyl)-3-oxa-11-azatetracyclo[6.5.1.11,10.04,14]pentadeca-4,6,8(14)-trien-5-ol |
| SMILES | CC[C@@]1(CCCOCc2ccoc2)[C@H]2Cc3ccc(O)c4c3[C@@]1(CCN2CC1CC1)[C@H](C(C)OC)O4 |
| InChI | InChI=1S/C30H41NO5/c1-4-29(11-5-14-34-18-22-10-15-35-19-22)25-16-23-8-9-24(32)27-26(23)30(29,28(36-27)20(2)33-3)12-13-31(25)17-21-6-7-21/h8-10,15,19-21,25,28,32H,4-7,11-14,16-18H2,1-3H3/t20?,25-,28+,29-,30+/m1/s1 |
| InChIKey | MMIWBQVGTAPPTC-RXARQDKWSA-N |
| XLogP | 5.45 |
| TPSA | 64.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.66 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|