C25H33NO5 — CID 25064332
(4R,4aS,6R,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-6-(3-methylbutoxy)-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one (PubChem CID 25064332) has the molecular formula C25H33NO5 and a molecular weight of 427.54 g/mol. Its IUPAC name is (4R,4aS,6R,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-6-(3-methylbutoxy)-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one.
| Compound Name | (4R,4aS,6R,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-6-(3-methylbutoxy)-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
|---|---|
| PubChem CID | 25064332 |
| Molecular Formula | C25H33NO5 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | (4R,4aS,6R,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-6-(3-methylbutoxy)-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
| SMILES | CC(C)CCO[C@@H]1C[C@@]2(O)[C@H]3Cc4ccc(O)c5c4[C@@]2(CCN3CC2CC2)[C@@H](O5)C1=O |
| InChI | InChI=1S/C25H33NO5/c1-14(2)7-10-30-18-12-25(29)19-11-16-5-6-17(27)22-20(16)24(25,23(31-22)21(18)28)8-9-26(19)13-15-3-4-15/h5-6,14-15,18-19,23,27,29H,3-4,7-13H2,1-2H3/t18-,19-,23+,24+,25-/m1/s1 |
| InChIKey | SFNZADOFCCGOER-MQJMNRKWSA-N |
| XLogP | 2.57 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |