C29H36N2O7 — CID 91362789
ethyl 1-[(4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-6-carbonyl]piperidine-4-carboxylate (PubChem CID 91362789) has the molecular formula C29H36N2O7 and a molecular weight of 524.61 g/mol. Its IUPAC name is ethyl 1-[(4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-6-carbonyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-6-carbonyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 91362789 |
| Molecular Formula | C29H36N2O7 |
| Molecular Weight | 524.61 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | ethyl 1-[(4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-6-carbonyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)C2C[C@@]3(O)[C@H]4Cc5ccc(O)c6c5[C@@]3(CCN4CC3CC3)[C@@H](O6)C2=O)CC1 |
| InChI | InChI=1S/C29H36N2O7/c1-2-37-27(35)17-7-10-30(11-8-17)26(34)19-14-29(36)21-13-18-5-6-20(32)24-22(18)28(29,25(38-24)23(19)33)9-12-31(21)15-16-3-4-16/h5-6,16-17,19,21,25,32,36H,2-4,7-15H2,1H3/t19?,21-,25+,28+,29-/m1/s1 |
| InChIKey | WGGRMKZIBOTMOT-BPNMELRZSA-N |
| XLogP | 1.55 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.61 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|