C27H27ClN2O7S — CID 91568031
(4R,4aS,7aR,12bS)-N-(4-chlorophenyl)sulfonyl-3-(cyclopropylmethyl)-4a,9-dihydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-6-carboxamide (PubChem CID 91568031) has the molecular formula C27H27ClN2O7S and a molecular weight of 559.04 g/mol. Its IUPAC name is (4R,4aS,7aR,12bS)-N-(4-chlorophenyl)sulfonyl-3-(cyclopropylmethyl)-4a,9-dihydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-6-carboxamide.
| Compound Name | (4R,4aS,7aR,12bS)-N-(4-chlorophenyl)sulfonyl-3-(cyclopropylmethyl)-4a,9-dihydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 91568031 |
| Molecular Formula | C27H27ClN2O7S |
| Molecular Weight | 559.04 g/mol |
| Exact Mass | 558.12 |
| IUPAC Name | (4R,4aS,7aR,12bS)-N-(4-chlorophenyl)sulfonyl-3-(cyclopropylmethyl)-4a,9-dihydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-6-carboxamide |
| SMILES | O=C(NS(=O)(=O)c1ccc(Cl)cc1)C1C[C@@]2(O)[C@H]3Cc4ccc(O)c5c4[C@@]2(CCN3CC2CC2)[C@@H](O5)C1=O |
| InChI | InChI=1S/C27H27ClN2O7S/c28-16-4-6-17(7-5-16)38(35,36)29-25(33)18-12-27(34)20-11-15-3-8-19(31)23-21(15)26(27,24(37-23)22(18)32)9-10-30(20)13-14-1-2-14/h3-8,14,18,20,24,31,34H,1-2,9-13H2,(H,29,33)/t18?,20-,24+,26+,27-/m1/s1 |
| InChIKey | SGWDRVVXODYXJH-CYYFMRKFSA-N |
| XLogP | 1.91 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.04 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|