C28H27N3O6 — CID 91257709
(4R,4aS,7aR,12bS)-N-(1,3-benzoxazol-6-yl)-3-(cyclopropylmethyl)-4a,9-dihydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-6-carboxamide (PubChem CID 91257709) has the molecular formula C28H27N3O6 and a molecular weight of 501.54 g/mol. Its IUPAC name is (4R,4aS,7aR,12bS)-N-(1,3-benzoxazol-6-yl)-3-(cyclopropylmethyl)-4a,9-dihydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-6-carboxamide.
| Compound Name | (4R,4aS,7aR,12bS)-N-(1,3-benzoxazol-6-yl)-3-(cyclopropylmethyl)-4a,9-dihydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 91257709 |
| Molecular Formula | C28H27N3O6 |
| Molecular Weight | 501.54 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | (4R,4aS,7aR,12bS)-N-(1,3-benzoxazol-6-yl)-3-(cyclopropylmethyl)-4a,9-dihydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-6-carboxamide |
| SMILES | O=C(Nc1ccc2ncoc2c1)C1C[C@@]2(O)[C@H]3Cc4ccc(O)c5c4[C@@]2(CCN3CC2CC2)[C@@H](O5)C1=O |
| InChI | InChI=1S/C28H27N3O6/c32-19-6-3-15-9-21-28(35)11-17(26(34)30-16-4-5-18-20(10-16)36-13-29-18)23(33)25-27(28,22(15)24(19)37-25)7-8-31(21)12-14-1-2-14/h3-6,10,13-14,17,21,25,32,35H,1-2,7-9,11-12H2,(H,30,34)/t17?,21-,25+,27+,28-/m1/s1 |
| InChIKey | GBASZGBMNWPFLH-ULEQVZJMSA-N |
| XLogP | 2.53 |
| TPSA | 125.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.54 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|