C27H27FN2O7S — CID 91279188
(4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-N-(2-fluorophenyl)sulfonyl-4a,9-dihydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-6-carboxamide (PubChem CID 91279188) has the molecular formula C27H27FN2O7S and a molecular weight of 542.59 g/mol. Its IUPAC name is (4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-N-(2-fluorophenyl)sulfonyl-4a,9-dihydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-6-carboxamide.
| Compound Name | (4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-N-(2-fluorophenyl)sulfonyl-4a,9-dihydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 91279188 |
| Molecular Formula | C27H27FN2O7S |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | (4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-N-(2-fluorophenyl)sulfonyl-4a,9-dihydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-6-carboxamide |
| SMILES | O=C(NS(=O)(=O)c1ccccc1F)C1C[C@@]2(O)[C@H]3Cc4ccc(O)c5c4[C@@]2(CCN3CC2CC2)[C@@H](O5)C1=O |
| InChI | InChI=1S/C27H27FN2O7S/c28-17-3-1-2-4-19(17)38(35,36)29-25(33)16-12-27(34)20-11-15-7-8-18(31)23-21(15)26(27,24(37-23)22(16)32)9-10-30(20)13-14-5-6-14/h1-4,7-8,14,16,20,24,31,34H,5-6,9-13H2,(H,29,33)/t16?,20-,24+,26+,27-/m1/s1 |
| InChIKey | FULJTCHPXSXXJK-SRNSWNTHSA-N |
| XLogP | 1.40 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|