C24H33NO3 — CID 137467268
(4R,7aR,12bS)-3-(cyclopropylmethyl)-7,9-dimethoxy-6,6-dimethyl-1,2,4,4a,5,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline (PubChem CID 137467268) has the molecular formula C24H33NO3 and a molecular weight of 383.53 g/mol. Its IUPAC name is (4R,7aR,12bS)-3-(cyclopropylmethyl)-7,9-dimethoxy-6,6-dimethyl-1,2,4,4a,5,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline.
| Compound Name | (4R,7aR,12bS)-3-(cyclopropylmethyl)-7,9-dimethoxy-6,6-dimethyl-1,2,4,4a,5,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline |
|---|---|
| PubChem CID | 137467268 |
| Molecular Formula | C24H33NO3 |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.25 |
| IUPAC Name | (4R,7aR,12bS)-3-(cyclopropylmethyl)-7,9-dimethoxy-6,6-dimethyl-1,2,4,4a,5,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline |
| SMILES | COc1ccc2c3c1O[C@H]1C(OC)C(C)(C)CC4[C@@H](C2)N(CC2CC2)CC[C@@]341 |
| InChI | InChI=1S/C24H33NO3/c1-23(2)12-16-17-11-15-7-8-18(26-3)20-19(15)24(16,22(28-20)21(23)27-4)9-10-25(17)13-14-5-6-14/h7-8,14,16-17,21-22H,5-6,9-13H2,1-4H3/t16?,17-,21?,22+,24+/m1/s1 |
| InChIKey | UPFUIOVQMOXWBN-YECODOTASA-N |
| XLogP | 3.80 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |