C30H37NO4 — CID 144507569
(7aR)-3-(cyclopropylmethyl)-7-methoxy-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol;(3,5-dimethylphenyl)methanol (PubChem CID 144507569) has the molecular formula C30H37NO4 and a molecular weight of 475.63 g/mol. Its IUPAC name is (7aR)-3-(cyclopropylmethyl)-7-methoxy-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol;(3,5-dimethylphenyl)methanol.
| Compound Name | (7aR)-3-(cyclopropylmethyl)-7-methoxy-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol;(3,5-dimethylphenyl)methanol |
|---|---|
| PubChem CID | 144507569 |
| Molecular Formula | C30H37NO4 |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.27 |
| IUPAC Name | (7aR)-3-(cyclopropylmethyl)-7-methoxy-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol;(3,5-dimethylphenyl)methanol |
| SMILES | COC1C=CC2C3Cc4ccc(O)c5c4C2(CCN3CC2CC2)[C@H]1O5.Cc1cc(C)cc(CO)c1 |
| InChI | InChI=1S/C21H25NO3.C9H12O/c1-24-17-7-5-14-15-10-13-4-6-16(23)19-18(13)21(14,20(17)25-19)8-9-22(15)11-12-2-3-12;1-7-3-8(2)5-9(4-7)6-10/h4-7,12,14-15,17,20,23H,2-3,8-11H2,1H3;3-5,10H,6H2,1-2H3/t14?,15?,17?,20-,21?;/m0./s1 |
| InChIKey | XTADLDZWXZGNCX-MNJVICSYSA-N |
| XLogP | 4.43 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|