C33H32N2O5 — CID 121296938
(4R,7S,7aR,12bS)-N-[2-[4-(1,3-benzodioxol-5-yl)phenyl]ethyl]-7-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-9-carboxamide (PubChem CID 121296938) has the molecular formula C33H32N2O5 and a molecular weight of 536.63 g/mol. Its IUPAC name is (4R,7S,7aR,12bS)-N-[2-[4-(1,3-benzodioxol-5-yl)phenyl]ethyl]-7-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-9-carboxamide.
| Compound Name | (4R,7S,7aR,12bS)-N-[2-[4-(1,3-benzodioxol-5-yl)phenyl]ethyl]-7-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-9-carboxamide |
|---|---|
| PubChem CID | 121296938 |
| Molecular Formula | C33H32N2O5 |
| Molecular Weight | 536.63 g/mol |
| Exact Mass | 536.23 |
| IUPAC Name | (4R,7S,7aR,12bS)-N-[2-[4-(1,3-benzodioxol-5-yl)phenyl]ethyl]-7-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-9-carboxamide |
| SMILES | CN1CC[C@]23c4c5ccc(C(=O)NCCc6ccc(-c7ccc8c(c7)OCO8)cc6)c4O[C@H]2[C@@H](O)C=CC3[C@H]1C5 |
| InChI | InChI=1S/C33H32N2O5/c1-35-15-13-33-24-9-10-26(36)31(33)40-30-23(8-6-22(29(30)33)16-25(24)35)32(37)34-14-12-19-2-4-20(5-3-19)21-7-11-27-28(17-21)39-18-38-27/h2-11,17,24-26,31,36H,12-16,18H2,1H3,(H,34,37)/t24?,25-,26+,31+,33+/m1/s1 |
| InChIKey | RVPNALBWDOAICN-QWMFUABISA-N |
| XLogP | 3.86 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.63 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|