C17H19FNO5P — CID 54131306
[(4R,4aR,7S,7aR,12bS)-7-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl]oxy-fluorophosphinic acid (PubChem CID 54131306) has the molecular formula C17H19FNO5P and a molecular weight of 367.31 g/mol. Its IUPAC name is [(4R,4aR,7S,7aR,12bS)-7-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl]oxy-fluorophosphinic acid.
| Compound Name | [(4R,4aR,7S,7aR,12bS)-7-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl]oxy-fluorophosphinic acid |
|---|---|
| PubChem CID | 54131306 |
| Molecular Formula | C17H19FNO5P |
| Molecular Weight | 367.31 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | [(4R,4aR,7S,7aR,12bS)-7-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl]oxy-fluorophosphinic acid |
| SMILES | CN1CC[C@]23c4c5ccc(OP(=O)(O)F)c4O[C@H]2[C@@H](O)C=C[C@H]3[C@H]1C5 |
| InChI | InChI=1S/C17H19FNO5P/c1-19-7-6-17-10-3-4-12(20)16(17)23-15-13(24-25(18,21)22)5-2-9(14(15)17)8-11(10)19/h2-5,10-12,16,20H,6-8H2,1H3,(H,21,22)/t10-,11+,12-,16-,17-/m0/s1 |
| InChIKey | NUOMPRAYOGJVAU-KOFBORESSA-N |
| XLogP | 1.94 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|